C8H11BrO3 — CID 90889510
(2-bromo-3,6-dihydro-2H-pyran-6-yl)methyl acetate (PubChem CID 90889510) has the molecular formula C8H11BrO3 and a molecular weight of 235.08 g/mol. Its IUPAC name is (2-bromo-3,6-dihydro-2H-pyran-6-yl)methyl acetate.
| Compound Name | (2-bromo-3,6-dihydro-2H-pyran-6-yl)methyl acetate |
|---|---|
| PubChem CID | 90889510 |
| Molecular Formula | C8H11BrO3 |
| Molecular Weight | 235.08 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | (2-bromo-3,6-dihydro-2H-pyran-6-yl)methyl acetate |
| SMILES | CC(=O)OCC1C=CCC(Br)O1 |
| InChI | InChI=1S/C8H11BrO3/c1-6(10)11-5-7-3-2-4-8(9)12-7/h2-3,7-8H,4-5H2,1H3 |
| InChIKey | RZRYBWWSFPLGTF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.08 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|