C24H24BrClO3 — CID 91224843
[(2S,6R)-2-[3-[[4-(3-bromoprop-1-en-2-yl)phenyl]methyl]-4-chlorophenyl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 91224843) has the molecular formula C24H24BrClO3 and a molecular weight of 475.81 g/mol. Its IUPAC name is [(2S,6R)-2-[3-[[4-(3-bromoprop-1-en-2-yl)phenyl]methyl]-4-chlorophenyl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [(2S,6R)-2-[3-[[4-(3-bromoprop-1-en-2-yl)phenyl]methyl]-4-chlorophenyl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 91224843 |
| Molecular Formula | C24H24BrClO3 |
| Molecular Weight | 475.81 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | [(2S,6R)-2-[3-[[4-(3-bromoprop-1-en-2-yl)phenyl]methyl]-4-chlorophenyl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | C=C(CBr)c1ccc(Cc2cc([C@@H]3CC=C[C@H](COC(C)=O)O3)ccc2Cl)cc1 |
| InChI | InChI=1S/C24H24BrClO3/c1-16(14-25)19-8-6-18(7-9-19)12-21-13-20(10-11-23(21)26)24-5-3-4-22(29-24)15-28-17(2)27/h3-4,6-11,13,22,24H,1,5,12,14-15H2,2H3/t22-,24+/m1/s1 |
| InChIKey | QXTYVMLZAYUAAG-VWNXMTODSA-N |
| XLogP | 6.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.81 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|