C29H39ClO5Si — CID 123416629
[2-[3-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]methyl]-4-chlorophenyl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 123416629) has the molecular formula C29H39ClO5Si and a molecular weight of 531.17 g/mol. Its IUPAC name is [2-[3-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]methyl]-4-chlorophenyl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [2-[3-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]methyl]-4-chlorophenyl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 123416629 |
| Molecular Formula | C29H39ClO5Si |
| Molecular Weight | 531.17 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | [2-[3-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]methyl]-4-chlorophenyl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | CC(=O)OCC1C=CCC(c2ccc(Cl)c(Cc3ccc(OCCO[Si](C)(C)C(C)(C)C)cc3)c2)O1 |
| InChI | InChI=1S/C29H39ClO5Si/c1-21(31)33-20-26-8-7-9-28(35-26)23-12-15-27(30)24(19-23)18-22-10-13-25(14-11-22)32-16-17-34-36(5,6)29(2,3)4/h7-8,10-15,19,26,28H,9,16-18,20H2,1-6H3 |
| InChIKey | OLEMAYQDKQKCMC-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.17 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|