C11H16O4 — CID 25170494
[(2R,3R,6S)-3-hydroxy-2-prop-2-enyl-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 25170494) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is [(2R,3R,6S)-3-hydroxy-2-prop-2-enyl-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [(2R,3R,6S)-3-hydroxy-2-prop-2-enyl-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 25170494 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | [(2R,3R,6S)-3-hydroxy-2-prop-2-enyl-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | C=CC[C@H]1O[C@H](COC(C)=O)C=C[C@H]1O |
| InChI | InChI=1S/C11H16O4/c1-3-4-11-10(13)6-5-9(15-11)7-14-8(2)12/h3,5-6,9-11,13H,1,4,7H2,2H3/t9-,10+,11+/m0/s1 |
| InChIKey | ISSXGPJXZWSDQA-HBNTYKKESA-N |
| XLogP | 0.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|