C16H20O5S — CID 71818668
[(2R,3S,6R)-3-hydroxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 71818668) has the molecular formula C16H20O5S and a molecular weight of 324.40 g/mol. Its IUPAC name is [(2R,3S,6R)-3-hydroxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,6R)-3-hydroxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71818668 |
| Molecular Formula | C16H20O5S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | [(2R,3S,6R)-3-hydroxy-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | C=CC[C@@H]1C=C[C@H](O)[C@@H](COS(=O)(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C16H20O5S/c1-3-4-13-7-10-15(17)16(21-13)11-20-22(18,19)14-8-5-12(2)6-9-14/h3,5-10,13,15-17H,1,4,11H2,2H3/t13-,15+,16-/m1/s1 |
| InChIKey | CFGTVSJEMYJLCZ-VNQPRFMTSA-N |
| XLogP | 1.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|