C21H23NO7S — CID 58061929
[(3S,6R)-6-(4-acetamidophenoxy)-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 58061929) has the molecular formula C21H23NO7S and a molecular weight of 433.48 g/mol. Its IUPAC name is [(3S,6R)-6-(4-acetamidophenoxy)-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3S,6R)-6-(4-acetamidophenoxy)-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58061929 |
| Molecular Formula | C21H23NO7S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | [(3S,6R)-6-(4-acetamidophenoxy)-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(O[C@@H]2C=C[C@H](O)C(COS(=O)(=O)c3ccc(C)cc3)O2)cc1 |
| InChI | InChI=1S/C21H23NO7S/c1-14-3-9-18(10-4-14)30(25,26)27-13-20-19(24)11-12-21(29-20)28-17-7-5-16(6-8-17)22-15(2)23/h3-12,19-21,24H,13H2,1-2H3,(H,22,23)/t19-,20?,21-/m0/s1 |
| InChIKey | XGYSBOGGCXDBHZ-YSTUSHMSSA-N |
| XLogP | 2.38 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|