C17H24O5Si — CID 100941806
[(1R,6R,9R,12S)-4-oxo-3-trimethylsilyl-8,13-dioxatricyclo[7.4.0.02,6]trideca-2,10-dien-12-yl]methyl acetate (PubChem CID 100941806) has the molecular formula C17H24O5Si and a molecular weight of 336.46 g/mol. Its IUPAC name is [(1R,6R,9R,12S)-4-oxo-3-trimethylsilyl-8,13-dioxatricyclo[7.4.0.02,6]trideca-2,10-dien-12-yl]methyl acetate.
| Compound Name | [(1R,6R,9R,12S)-4-oxo-3-trimethylsilyl-8,13-dioxatricyclo[7.4.0.02,6]trideca-2,10-dien-12-yl]methyl acetate |
|---|---|
| PubChem CID | 100941806 |
| Molecular Formula | C17H24O5Si |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | [(1R,6R,9R,12S)-4-oxo-3-trimethylsilyl-8,13-dioxatricyclo[7.4.0.02,6]trideca-2,10-dien-12-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C=C[C@H]2OC[C@@H]3CC(=O)C([Si](C)(C)C)=C3[C@H]2O1 |
| InChI | InChI=1S/C17H24O5Si/c1-10(18)20-9-12-5-6-14-16(22-12)15-11(8-21-14)7-13(19)17(15)23(2,3)4/h5-6,11-12,14,16H,7-9H2,1-4H3/t11-,12-,14+,16-/m0/s1 |
| InChIKey | QJLHOEMUJLEUFH-GMZLATJGSA-N |
| XLogP | 2.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|