C10H16N2O3S — CID 91131254
[(3R,6R)-3-(methylcarbamothioylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 91131254) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is [(3R,6R)-3-(methylcarbamothioylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [(3R,6R)-3-(methylcarbamothioylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 91131254 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | [(3R,6R)-3-(methylcarbamothioylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | CNC(=S)N[C@@H]1C=C[C@H](COC(C)=O)OC1 |
| InChI | InChI=1S/C10H16N2O3S/c1-7(13)14-6-9-4-3-8(5-15-9)12-10(16)11-2/h3-4,8-9H,5-6H2,1-2H3,(H2,11,12,16)/t8-,9-/m1/s1 |
| InChIKey | HFGPDWPOEISCCG-RKDXNWHRSA-N |
| XLogP | -0.03 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|