C11H15F3N2O3S — CID 91617333
[(3R,6R)-3-(2,2,2-trifluoroethylcarbamothioylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 91617333) has the molecular formula C11H15F3N2O3S and a molecular weight of 312.31 g/mol. Its IUPAC name is [(3R,6R)-3-(2,2,2-trifluoroethylcarbamothioylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [(3R,6R)-3-(2,2,2-trifluoroethylcarbamothioylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 91617333 |
| Molecular Formula | C11H15F3N2O3S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [(3R,6R)-3-(2,2,2-trifluoroethylcarbamothioylamino)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C=C[C@@H](NC(=S)NCC(F)(F)F)CO1 |
| InChI | InChI=1S/C11H15F3N2O3S/c1-7(17)18-5-9-3-2-8(4-19-9)16-10(20)15-6-11(12,13)14/h2-3,8-9H,4-6H2,1H3,(H2,15,16,20)/t8-,9-/m1/s1 |
| InChIKey | QMBSAKNFHZWNFU-RKDXNWHRSA-N |
| XLogP | 0.90 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|