C10H15NO3 — CID 10867271
[(1S,4R)-4-acetamidocyclopent-2-en-1-yl]methyl acetate (PubChem CID 10867271) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is [(1S,4R)-4-acetamidocyclopent-2-en-1-yl]methyl acetate.
| Compound Name | [(1S,4R)-4-acetamidocyclopent-2-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10867271 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | [(1S,4R)-4-acetamidocyclopent-2-en-1-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1C=C[C@@H](COC(C)=O)C1 |
| InChI | InChI=1S/C10H15NO3/c1-7(12)11-10-4-3-9(5-10)6-14-8(2)13/h3-4,9-10H,5-6H2,1-2H3,(H,11,12)/t9-,10+/m1/s1 |
| InChIKey | NUVGPCPCBFRPHQ-ZJUUUORDSA-N |
| XLogP | 0.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|