C9H15NO2 — CID 10877544
[(1S,4R)-4-(aminomethyl)cyclopent-2-en-1-yl]methyl acetate (PubChem CID 10877544) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is [(1S,4R)-4-(aminomethyl)cyclopent-2-en-1-yl]methyl acetate.
| Compound Name | [(1S,4R)-4-(aminomethyl)cyclopent-2-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10877544 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | [(1S,4R)-4-(aminomethyl)cyclopent-2-en-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C=C[C@H](CN)C1 |
| InChI | InChI=1S/C9H15NO2/c1-7(11)12-6-9-3-2-8(4-9)5-10/h2-3,8-9H,4-6,10H2,1H3/t8-,9+/m0/s1 |
| InChIKey | XNVQYTREKQJAQK-DTWKUNHWSA-N |
| XLogP | 0.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|