About azetidin-3-ylmethyl acetate
azetidin-3-ylmethyl acetate (PubChem CID 66592470) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is azetidin-3-ylmethyl acetate.
Molecular Properties
| Compound Name | azetidin-3-ylmethyl acetate |
| PubChem CID | 66592470 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | azetidin-3-ylmethyl acetate |
| SMILES | CC(=O)OCC1CNC1 |
| InChI | InChI=1S/C6H11NO2/c1-5(8)9-4-6-2-7-3-6/h6-7H,2-4H2,1H3 |
| InChIKey | WEBKPCMSYJOTNH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azetidin-3-ylmethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-3-ylmethyl acetate?
The IUPAC name of azetidin-3-ylmethyl acetate (CID 66592470) is azetidin-3-ylmethyl acetate.
What is the SMILES notation for azetidin-3-ylmethyl acetate?
The canonical SMILES for azetidin-3-ylmethyl acetate is CC(=O)OCC1CNC1.
What is the InChIKey of azetidin-3-ylmethyl acetate?
The InChIKey is WEBKPCMSYJOTNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-5(8)9-4-6-2-7-3-6/h6-7H,2-4H2,1H3.
What are the key properties of azetidin-3-ylmethyl acetate?
azetidin-3-ylmethyl acetate has a molecular weight of 129.16 g/mol, XLogP of -0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-3-ylmethyl acetate is sourced from PubChem (CID 66592470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).