C13H29N5O2 — CID 101060492
1,4,7,10,13-pentazacyclopentadec-2-ylmethyl acetate (PubChem CID 101060492) has the molecular formula C13H29N5O2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 1,4,7,10,13-pentazacyclopentadec-2-ylmethyl acetate.
| Compound Name | 1,4,7,10,13-pentazacyclopentadec-2-ylmethyl acetate |
|---|---|
| PubChem CID | 101060492 |
| Molecular Formula | C13H29N5O2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.23 |
| IUPAC Name | 1,4,7,10,13-pentazacyclopentadec-2-ylmethyl acetate |
| SMILES | CC(=O)OCC1CNCCNCCNCCNCCN1 |
| InChI | InChI=1S/C13H29N5O2/c1-12(19)20-11-13-10-17-7-6-15-3-2-14-4-5-16-8-9-18-13/h13-18H,2-11H2,1H3 |
| InChIKey | RTNVTBQZFCWYBV-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |