About piperazin-2-ylmethyl N-butylcarbamate
piperazin-2-ylmethyl N-butylcarbamate (PubChem CID 11173728) has the molecular formula C10H21N3O2
and a molecular weight of 215.30 g/mol. Its IUPAC name is piperazin-2-ylmethyl N-butylcarbamate.
Molecular Properties
| Compound Name | piperazin-2-ylmethyl N-butylcarbamate |
| PubChem CID | 11173728 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | piperazin-2-ylmethyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OCC1CNCCN1 |
| InChI | InChI=1S/C10H21N3O2/c1-2-3-4-13-10(14)15-8-9-7-11-5-6-12-9/h9,11-12H,2-8H2,1H3,(H,13,14) |
| InChIKey | GOZUOIGFCJENPZ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze piperazin-2-ylmethyl N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazin-2-ylmethyl N-butylcarbamate?
The IUPAC name of piperazin-2-ylmethyl N-butylcarbamate (CID 11173728) is piperazin-2-ylmethyl N-butylcarbamate.
What is the SMILES notation for piperazin-2-ylmethyl N-butylcarbamate?
The canonical SMILES for piperazin-2-ylmethyl N-butylcarbamate is CCCCNC(=O)OCC1CNCCN1.
What is the InChIKey of piperazin-2-ylmethyl N-butylcarbamate?
The InChIKey is GOZUOIGFCJENPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O2/c1-2-3-4-13-10(14)15-8-9-7-11-5-6-12-9/h9,11-12H,2-8H2,1H3,(H,13,14).
What are the key properties of piperazin-2-ylmethyl N-butylcarbamate?
piperazin-2-ylmethyl N-butylcarbamate has a molecular weight of 215.30 g/mol, XLogP of 0.07, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazin-2-ylmethyl N-butylcarbamate is sourced from PubChem (CID 11173728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).