C15H34N6O2 — CID 101060497
1,4,7,10,13,16-hexazacyclooctadec-2-ylmethyl acetate (PubChem CID 101060497) has the molecular formula C15H34N6O2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 1,4,7,10,13,16-hexazacyclooctadec-2-ylmethyl acetate.
| Compound Name | 1,4,7,10,13,16-hexazacyclooctadec-2-ylmethyl acetate |
|---|---|
| PubChem CID | 101060497 |
| Molecular Formula | C15H34N6O2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | 1,4,7,10,13,16-hexazacyclooctadec-2-ylmethyl acetate |
| SMILES | CC(=O)OCC1CNCCNCCNCCNCCNCCN1 |
| InChI | InChI=1S/C15H34N6O2/c1-14(22)23-13-15-12-20-9-8-18-5-4-16-2-3-17-6-7-19-10-11-21-15/h15-21H,2-13H2,1H3 |
| InChIKey | CTNWKNZJXPNZOH-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |