About 2-pyrrolidin-3-ylethyl N-butylcarbamate
2-pyrrolidin-3-ylethyl N-butylcarbamate (PubChem CID 114796626) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-pyrrolidin-3-ylethyl N-butylcarbamate.
Molecular Properties
| Compound Name | 2-pyrrolidin-3-ylethyl N-butylcarbamate |
| PubChem CID | 114796626 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-pyrrolidin-3-ylethyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OCCC1CCNC1 |
| InChI | InChI=1S/C11H22N2O2/c1-2-3-6-13-11(14)15-8-5-10-4-7-12-9-10/h10,12H,2-9H2,1H3,(H,13,14) |
| InChIKey | WYCDAUCJTKOTPR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrrolidin-3-ylethyl N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-3-ylethyl N-butylcarbamate?
The IUPAC name of 2-pyrrolidin-3-ylethyl N-butylcarbamate (CID 114796626) is 2-pyrrolidin-3-ylethyl N-butylcarbamate.
What is the SMILES notation for 2-pyrrolidin-3-ylethyl N-butylcarbamate?
The canonical SMILES for 2-pyrrolidin-3-ylethyl N-butylcarbamate is CCCCNC(=O)OCCC1CCNC1.
What is the InChIKey of 2-pyrrolidin-3-ylethyl N-butylcarbamate?
The InChIKey is WYCDAUCJTKOTPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-2-3-6-13-11(14)15-8-5-10-4-7-12-9-10/h10,12H,2-9H2,1H3,(H,13,14).
What are the key properties of 2-pyrrolidin-3-ylethyl N-butylcarbamate?
2-pyrrolidin-3-ylethyl N-butylcarbamate has a molecular weight of 214.31 g/mol, XLogP of 1.51, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-3-ylethyl N-butylcarbamate is sourced from PubChem (CID 114796626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).