C10H16O4 — CID 11745661
[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]methyl 2-methoxyacetate (PubChem CID 11745661) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]methyl 2-methoxyacetate.
| Compound Name | [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]methyl 2-methoxyacetate |
|---|---|
| PubChem CID | 11745661 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | [(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]methyl 2-methoxyacetate |
| SMILES | COCC(=O)OC[C@H]1C=C[C@@H](CO)C1 |
| InChI | InChI=1S/C10H16O4/c1-13-7-10(12)14-6-9-3-2-8(4-9)5-11/h2-3,8-9,11H,4-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | MCWGLEVAMWYTOS-BDAKNGLRSA-N |
| XLogP | 0.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|