C12H23ClN2O2 — CID 159585552
bis([(1S,4R)-4-aminocyclopent-2-en-1-yl]methanol);hydrochloride (PubChem CID 159585552) has the molecular formula C12H23ClN2O2 and a molecular weight of 262.78 g/mol. Its IUPAC name is bis([(1S,4R)-4-aminocyclopent-2-en-1-yl]methanol);hydrochloride.
| Compound Name | bis([(1S,4R)-4-aminocyclopent-2-en-1-yl]methanol);hydrochloride |
|---|---|
| PubChem CID | 159585552 |
| Molecular Formula | C12H23ClN2O2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | bis([(1S,4R)-4-aminocyclopent-2-en-1-yl]methanol);hydrochloride |
| SMILES | Cl.N[C@H]1C=C[C@@H](CO)C1.N[C@H]1C=C[C@@H](CO)C1 |
| InChI | InChI=1S/2C6H11NO.ClH/c2*7-6-2-1-5(3-6)4-8;/h2*1-2,5-6,8H,3-4,7H2;1H/t2*5-,6+;/m11./s1 |
| InChIKey | VZEWSLPYWIIMDO-GPOYHVNWSA-N |
| XLogP | 0.19 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|