C10H12O3 — CID 121215891
[(1S,2S,4S)-7-oxo-2-bicyclo[2.2.1]hept-5-enyl]methyl acetate (PubChem CID 121215891) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is [(1S,2S,4S)-7-oxo-2-bicyclo[2.2.1]hept-5-enyl]methyl acetate.
| Compound Name | [(1S,2S,4S)-7-oxo-2-bicyclo[2.2.1]hept-5-enyl]methyl acetate |
|---|---|
| PubChem CID | 121215891 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | [(1S,2S,4S)-7-oxo-2-bicyclo[2.2.1]hept-5-enyl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@H]2C=C[C@@H]1C2=O |
| InChI | InChI=1S/C10H12O3/c1-6(11)13-5-8-4-7-2-3-9(8)10(7)12/h2-3,7-9H,4-5H2,1H3/t7-,8-,9+/m1/s1 |
| InChIKey | OFGVRQZAWZMSPQ-HLTSFMKQSA-N |
| XLogP | 0.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|