About fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate
fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate (PubChem CID 145013221) has the molecular formula C13H17FO3
and a molecular weight of 240.27 g/mol. Its IUPAC name is fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate.
Molecular Properties
| Compound Name | fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate |
| PubChem CID | 145013221 |
| Molecular Formula | C13H17FO3 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate |
| SMILES | CC(=O)OCC1CC1CO.Fc1ccccc1 |
| InChI | InChI=1S/C7H12O3.C6H5F/c1-5(9)10-4-7-2-6(7)3-8;7-6-4-2-1-3-5-6/h6-8H,2-4H2,1H3;1-5H |
| InChIKey | RYIHEYKSZZLEBN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate?
The IUPAC name of fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate (CID 145013221) is fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate.
What is the SMILES notation for fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate?
The canonical SMILES for fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate is CC(=O)OCC1CC1CO.Fc1ccccc1.
What is the InChIKey of fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate?
The InChIKey is RYIHEYKSZZLEBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3.C6H5F/c1-5(9)10-4-7-2-6(7)3-8;7-6-4-2-1-3-5-6/h6-8H,2-4H2,1H3;1-5H.
What are the key properties of fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate?
fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate has a molecular weight of 240.27 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluorobenzene;[2-(hydroxymethyl)cyclopropyl]methyl acetate is sourced from PubChem (CID 145013221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).