C32H39NO3 — CID 71300186
N-[(2R,3R,4S,5S,6S)-5-methyl-2,4-bis(2-phenylethyl)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 71300186) has the molecular formula C32H39NO3 and a molecular weight of 485.67 g/mol. Its IUPAC name is N-[(2R,3R,4S,5S,6S)-5-methyl-2,4-bis(2-phenylethyl)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4S,5S,6S)-5-methyl-2,4-bis(2-phenylethyl)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 71300186 |
| Molecular Formula | C32H39NO3 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | N-[(2R,3R,4S,5S,6S)-5-methyl-2,4-bis(2-phenylethyl)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](CCc2ccccc2)[C@H](C)[C@@H](COCc2ccccc2)O[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C32H39NO3/c1-24-29(20-18-26-12-6-3-7-13-26)32(33-25(2)34)30(21-19-27-14-8-4-9-15-27)36-31(24)23-35-22-28-16-10-5-11-17-28/h3-17,24,29-32H,18-23H2,1-2H3,(H,33,34)/t24-,29-,30+,31+,32+/m0/s1 |
| InChIKey | LKNVPXFVIXXDBZ-CAUGGUKASA-N |
| XLogP | 5.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |