C28H43NO4 — CID 121338906
tert-butyl (5S)-2,2-dimethyl-5-[[(2R,3R,4R,5S)-3-methyl-4-[2-(4-methylphenyl)ethyl]-5-prop-2-enyloxolan-2-yl]methyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 121338906) has the molecular formula C28H43NO4 and a molecular weight of 457.66 g/mol. Its IUPAC name is tert-butyl (5S)-2,2-dimethyl-5-[[(2R,3R,4R,5S)-3-methyl-4-[2-(4-methylphenyl)ethyl]-5-prop-2-enyloxolan-2-yl]methyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (5S)-2,2-dimethyl-5-[[(2R,3R,4R,5S)-3-methyl-4-[2-(4-methylphenyl)ethyl]-5-prop-2-enyloxolan-2-yl]methyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 121338906 |
| Molecular Formula | C28H43NO4 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | tert-butyl (5S)-2,2-dimethyl-5-[[(2R,3R,4R,5S)-3-methyl-4-[2-(4-methylphenyl)ethyl]-5-prop-2-enyloxolan-2-yl]methyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CC[C@@H]1O[C@H](C[C@H]2CN(C(=O)OC(C)(C)C)C(C)(C)O2)[C@H](C)[C@H]1CCc1ccc(C)cc1 |
| InChI | InChI=1S/C28H43NO4/c1-9-10-24-23(16-15-21-13-11-19(2)12-14-21)20(3)25(31-24)17-22-18-29(28(7,8)32-22)26(30)33-27(4,5)6/h9,11-14,20,22-25H,1,10,15-18H2,2-8H3/t20-,22+,23-,24+,25-/m1/s1 |
| InChIKey | GSKPEYXARZGIHP-WRUQEBNYSA-N |
| XLogP | 6.29 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|