C16H26F3N3O6S — CID 175723641
tert-butyl 2,2-dimethyl-5-[(2-methylpyrazol-2-ium-1-yl)methyl]-1,3-oxazolidine-3-carboxylate;trifluoromethanesulfonate (PubChem CID 175723641) has the molecular formula C16H26F3N3O6S and a molecular weight of 445.46 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-5-[(2-methylpyrazol-2-ium-1-yl)methyl]-1,3-oxazolidine-3-carboxylate;trifluoromethanesulfonate.
| Compound Name | tert-butyl 2,2-dimethyl-5-[(2-methylpyrazol-2-ium-1-yl)methyl]-1,3-oxazolidine-3-carboxylate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175723641 |
| Molecular Formula | C16H26F3N3O6S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | tert-butyl 2,2-dimethyl-5-[(2-methylpyrazol-2-ium-1-yl)methyl]-1,3-oxazolidine-3-carboxylate;trifluoromethanesulfonate |
| SMILES | C[n+]1cccn1CC1CN(C(=O)OC(C)(C)C)C(C)(C)O1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C15H26N3O3.CHF3O3S/c1-14(2,3)21-13(19)18-11-12(20-15(18,4)5)10-17-9-7-8-16(17)6;2-1(3,4)8(5,6)7/h7-9,12H,10-11H2,1-6H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | ZDXNQDOXZRQCHK-UHFFFAOYSA-M |
| XLogP | 1.74 |
| TPSA | 104.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|