C15H25F3N4O7S2 — CID 126507794
tert-butyl (2S)-2-methyl-4-(3-methylimidazol-3-ium-1-yl)sulfonylpiperazine-1-carboxylate;trifluoromethanesulfonate (PubChem CID 126507794) has the molecular formula C15H25F3N4O7S2 and a molecular weight of 494.51 g/mol. Its IUPAC name is tert-butyl (2S)-2-methyl-4-(3-methylimidazol-3-ium-1-yl)sulfonylpiperazine-1-carboxylate;trifluoromethanesulfonate.
| Compound Name | tert-butyl (2S)-2-methyl-4-(3-methylimidazol-3-ium-1-yl)sulfonylpiperazine-1-carboxylate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 126507794 |
| Molecular Formula | C15H25F3N4O7S2 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | tert-butyl (2S)-2-methyl-4-(3-methylimidazol-3-ium-1-yl)sulfonylpiperazine-1-carboxylate;trifluoromethanesulfonate |
| SMILES | C[C@H]1CN(S(=O)(=O)n2cc[n+](C)c2)CCN1C(=O)OC(C)(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H25N4O4S.CHF3O3S/c1-12-10-16(23(20,21)17-7-6-15(5)11-17)8-9-18(12)13(19)22-14(2,3)4;2-1(3,4)8(5,6)7/h6-7,11-12H,8-10H2,1-5H3;(H,5,6,7)/q+1;/p-1/t12-;/m0./s1 |
| InChIKey | JCWPFDMOFRGSMH-YDALLXLXSA-M |
| XLogP | 0.40 |
| TPSA | 132.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|