C16H17ClF3N3O5S2 — CID 139490874
4-(2-chlorophenyl)-1-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,6-dihydro-2H-pyridine;trifluoromethanesulfonate (PubChem CID 139490874) has the molecular formula C16H17ClF3N3O5S2 and a molecular weight of 487.91 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-1-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,6-dihydro-2H-pyridine;trifluoromethanesulfonate.
| Compound Name | 4-(2-chlorophenyl)-1-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,6-dihydro-2H-pyridine;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139490874 |
| Molecular Formula | C16H17ClF3N3O5S2 |
| Molecular Weight | 487.91 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | 4-(2-chlorophenyl)-1-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,6-dihydro-2H-pyridine;trifluoromethanesulfonate |
| SMILES | C[n+]1ccn(S(=O)(=O)N2CC=C(c3ccccc3Cl)CC2)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C15H17ClN3O2S.CHF3O3S/c1-17-10-11-19(12-17)22(20,21)18-8-6-13(7-9-18)14-4-2-3-5-15(14)16;2-1(3,4)8(5,6)7/h2-6,10-12H,7-9H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | OIDIXICGPWJRNS-UHFFFAOYSA-M |
| XLogP | 1.90 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.91 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|