C16H18ClF3N3O5S2+ — CID 175092287
4-(4-chlorophenyl)-1-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,6-dihydro-2H-pyridine;trifluoromethanesulfonic acid (PubChem CID 175092287) has the molecular formula C16H18ClF3N3O5S2+ and a molecular weight of 488.92 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,6-dihydro-2H-pyridine;trifluoromethanesulfonic acid.
| Compound Name | 4-(4-chlorophenyl)-1-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,6-dihydro-2H-pyridine;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 175092287 |
| Molecular Formula | C16H18ClF3N3O5S2+ |
| Molecular Weight | 488.92 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 4-(4-chlorophenyl)-1-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,6-dihydro-2H-pyridine;trifluoromethanesulfonic acid |
| SMILES | C[n+]1ccn(S(=O)(=O)N2CC=C(c3ccc(Cl)cc3)CC2)c1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C15H17ClN3O2S.CHF3O3S/c1-17-10-11-19(12-17)22(20,21)18-8-6-14(7-9-18)13-2-4-15(16)5-3-13;2-1(3,4)8(5,6)7/h2-6,10-12H,7-9H2,1H3;(H,5,6,7)/q+1; |
| InChIKey | LNSREKHSLYBIDI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 100.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.92 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|