C17H20F3N4O6S2+ — CID 175094005
2-[1-(3-methylimidazol-3-ium-1-yl)sulfonylpiperidin-4-yl]-1,3-benzoxazole;trifluoromethanesulfonic acid (PubChem CID 175094005) has the molecular formula C17H20F3N4O6S2+ and a molecular weight of 497.50 g/mol. Its IUPAC name is 2-[1-(3-methylimidazol-3-ium-1-yl)sulfonylpiperidin-4-yl]-1,3-benzoxazole;trifluoromethanesulfonic acid.
| Compound Name | 2-[1-(3-methylimidazol-3-ium-1-yl)sulfonylpiperidin-4-yl]-1,3-benzoxazole;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 175094005 |
| Molecular Formula | C17H20F3N4O6S2+ |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 2-[1-(3-methylimidazol-3-ium-1-yl)sulfonylpiperidin-4-yl]-1,3-benzoxazole;trifluoromethanesulfonic acid |
| SMILES | C[n+]1ccn(S(=O)(=O)N2CCC(c3nc4ccccc4o3)CC2)c1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C16H19N4O3S.CHF3O3S/c1-18-10-11-20(12-18)24(21,22)19-8-6-13(7-9-19)16-17-14-4-2-3-5-15(14)23-16;2-1(3,4)8(5,6)7/h2-5,10-13H,6-9H2,1H3;(H,5,6,7)/q+1; |
| InChIKey | QEAFEYPULAUETJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|