About 4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-sulfonyl chloride
4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-sulfonyl chloride (PubChem CID 86204306) has the molecular formula C11H11ClFNO2S
and a molecular weight of 275.73 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-sulfonyl chloride.
Analyze 4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-sulfonyl chloride?
The IUPAC name of 4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-sulfonyl chloride (CID 86204306) is 4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-sulfonyl chloride.
What is the SMILES notation for 4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-sulfonyl chloride?
The canonical SMILES for 4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-sulfonyl chloride is O=S(=O)(Cl)N1CC=C(c2ccc(F)cc2)CC1.
What is the InChIKey of 4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-sulfonyl chloride?
The InChIKey is QKDPUUVSMMSKAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClFNO2S/c12-17(15,16)14-7-5-10(6-8-14)9-1-3-11(13)4-2-9/h1-5H,6-8H2.
What are the key properties of 4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-sulfonyl chloride?
4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-sulfonyl chloride has a molecular weight of 275.73 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine-1-sulfonyl chloride is sourced from PubChem (CID 86204306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).