C21H24FNO2S — CID 3816431
1-(4-butylphenyl)sulfonyl-4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine (PubChem CID 3816431) has the molecular formula C21H24FNO2S and a molecular weight of 373.49 g/mol. Its IUPAC name is 1-(4-butylphenyl)sulfonyl-4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(4-butylphenyl)sulfonyl-4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 3816431 |
| Molecular Formula | C21H24FNO2S |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-(4-butylphenyl)sulfonyl-4-(4-fluorophenyl)-3,6-dihydro-2H-pyridine |
| SMILES | CCCCc1ccc(S(=O)(=O)N2CC=C(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H24FNO2S/c1-2-3-4-17-5-11-21(12-6-17)26(24,25)23-15-13-19(14-16-23)18-7-9-20(22)10-8-18/h5-13H,2-4,14-16H2,1H3 |
| InChIKey | HYNVMJXXAXCIHZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |