C22H30N2O4S2 — CID 19684732
1-(4-butylphenyl)sulfonyl-4-(2,5-dimethylphenyl)sulfonylpiperazine (PubChem CID 19684732) has the molecular formula C22H30N2O4S2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 1-(4-butylphenyl)sulfonyl-4-(2,5-dimethylphenyl)sulfonylpiperazine.
| Compound Name | 1-(4-butylphenyl)sulfonyl-4-(2,5-dimethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 19684732 |
| Molecular Formula | C22H30N2O4S2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 1-(4-butylphenyl)sulfonyl-4-(2,5-dimethylphenyl)sulfonylpiperazine |
| SMILES | CCCCc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3cc(C)ccc3C)CC2)cc1 |
| InChI | InChI=1S/C22H30N2O4S2/c1-4-5-6-20-9-11-21(12-10-20)29(25,26)23-13-15-24(16-14-23)30(27,28)22-17-18(2)7-8-19(22)3/h7-12,17H,4-6,13-16H2,1-3H3 |
| InChIKey | YJEZXRSSTFYRAU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |