C17H16ClNO2S — CID 3819741
1-(2-chlorophenyl)sulfonyl-4-phenyl-3,6-dihydro-2H-pyridine (PubChem CID 3819741) has the molecular formula C17H16ClNO2S and a molecular weight of 333.84 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-4-phenyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-4-phenyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 3819741 |
| Molecular Formula | C17H16ClNO2S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-4-phenyl-3,6-dihydro-2H-pyridine |
| SMILES | O=S(=O)(c1ccccc1Cl)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H16ClNO2S/c18-16-8-4-5-9-17(16)22(20,21)19-12-10-15(11-13-19)14-6-2-1-3-7-14/h1-10H,11-13H2 |
| InChIKey | WTEPJOSFTONWAG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |