C17H16ClNO3S — CID 139619038
3-[1-(4-chlorophenyl)sulfonyl-3,6-dihydro-2H-pyridin-4-yl]phenol (PubChem CID 139619038) has the molecular formula C17H16ClNO3S and a molecular weight of 349.84 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)sulfonyl-3,6-dihydro-2H-pyridin-4-yl]phenol.
| Compound Name | 3-[1-(4-chlorophenyl)sulfonyl-3,6-dihydro-2H-pyridin-4-yl]phenol |
|---|---|
| PubChem CID | 139619038 |
| Molecular Formula | C17H16ClNO3S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 3-[1-(4-chlorophenyl)sulfonyl-3,6-dihydro-2H-pyridin-4-yl]phenol |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CC=C(c2cccc(O)c2)CC1 |
| InChI | InChI=1S/C17H16ClNO3S/c18-15-4-6-17(7-5-15)23(21,22)19-10-8-13(9-11-19)14-2-1-3-16(20)12-14/h1-8,12,20H,9-11H2 |
| InChIKey | LAIOPXISNLACKA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |