About 7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one
7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one (PubChem CID 6624112) has the molecular formula C19H18N2O3S2
and a molecular weight of 386.50 g/mol. Its IUPAC name is 7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one |
| PubChem CID | 6624112 |
| Molecular Formula | C19H18N2O3S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2cc(S(=O)(=O)N3CC=C(c4ccccc4)CC3)ccc2N1 |
| InChI | InChI=1S/C19H18N2O3S2/c22-19-13-25-18-12-16(6-7-17(18)20-19)26(23,24)21-10-8-15(9-11-21)14-4-2-1-3-5-14/h1-8,12H,9-11,13H2,(H,20,22) |
| InChIKey | GPDALZKVUBPOIE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one?
The IUPAC name of 7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one (CID 6624112) is 7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for 7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one?
The canonical SMILES for 7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one is O=C1CSc2cc(S(=O)(=O)N3CC=C(c4ccccc4)CC3)ccc2N1.
What is the InChIKey of 7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one?
The InChIKey is GPDALZKVUBPOIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3S2/c22-19-13-25-18-12-16(6-7-17(18)20-19)26(23,24)21-10-8-15(9-11-21)14-4-2-1-3-5-14/h1-8,12H,9-11,13H2,(H,20,22).
What are the key properties of 7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one?
7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one has a molecular weight of 386.50 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 6624112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).