C13H15ClN3O2S+ — CID 139490785
5-chloro-2-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,4-dihydro-1H-isoquinoline (PubChem CID 139490785) has the molecular formula C13H15ClN3O2S+ and a molecular weight of 312.80 g/mol. Its IUPAC name is 5-chloro-2-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 5-chloro-2-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 139490785 |
| Molecular Formula | C13H15ClN3O2S+ |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 5-chloro-2-(3-methylimidazol-3-ium-1-yl)sulfonyl-3,4-dihydro-1H-isoquinoline |
| SMILES | C[n+]1ccn(S(=O)(=O)N2CCc3c(Cl)cccc3C2)c1 |
| InChI | InChI=1S/C13H15ClN3O2S/c1-15-7-8-17(10-15)20(18,19)16-6-5-12-11(9-16)3-2-4-13(12)14/h2-4,7-8,10H,5-6,9H2,1H3/q+1 |
| InChIKey | YYDNSQGMUJFBME-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|