C13H19N3O2S — CID 114523604
2-pyrrolidin-1-ylsulfonyl-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 114523604) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylsulfonyl-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | 2-pyrrolidin-1-ylsulfonyl-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 114523604 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-pyrrolidin-1-ylsulfonyl-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | Nc1cccc2c1CN(S(=O)(=O)N1CCCC1)CC2 |
| InChI | InChI=1S/C13H19N3O2S/c14-13-5-3-4-11-6-9-16(10-12(11)13)19(17,18)15-7-1-2-8-15/h3-5H,1-2,6-10,14H2 |
| InChIKey | LKOIYQIQRDROOR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|