C13H12Cl2N2O2S2 — CID 114523736
2-(2,5-dichlorothiophen-3-yl)sulfonyl-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 114523736) has the molecular formula C13H12Cl2N2O2S2 and a molecular weight of 363.29 g/mol. Its IUPAC name is 2-(2,5-dichlorothiophen-3-yl)sulfonyl-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | 2-(2,5-dichlorothiophen-3-yl)sulfonyl-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 114523736 |
| Molecular Formula | C13H12Cl2N2O2S2 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 2-(2,5-dichlorothiophen-3-yl)sulfonyl-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | Nc1cccc2c1CN(S(=O)(=O)c1cc(Cl)sc1Cl)CC2 |
| InChI | InChI=1S/C13H12Cl2N2O2S2/c14-12-6-11(13(15)20-12)21(18,19)17-5-4-8-2-1-3-10(16)9(8)7-17/h1-3,6H,4-5,7,16H2 |
| InChIKey | PGTNULOFTGKXNN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|