C14H15N3O2S — CID 114523706
2-pyridin-3-ylsulfonyl-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 114523706) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-pyridin-3-ylsulfonyl-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | 2-pyridin-3-ylsulfonyl-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 114523706 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-pyridin-3-ylsulfonyl-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | Nc1cccc2c1CN(S(=O)(=O)c1cccnc1)CC2 |
| InChI | InChI=1S/C14H15N3O2S/c15-14-5-1-3-11-6-8-17(10-13(11)14)20(18,19)12-4-2-7-16-9-12/h1-5,7,9H,6,8,10,15H2 |
| InChIKey | CCHUVAZGBGKOIO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|