C16H18N2O2S — CID 61019131
2-(3-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-5-amine (PubChem CID 61019131) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-(3-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-5-amine.
| Compound Name | 2-(3-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-5-amine |
|---|---|
| PubChem CID | 61019131 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-(3-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-5-amine |
| SMILES | Cc1cccc(S(=O)(=O)N2CCc3c(N)cccc3C2)c1 |
| InChI | InChI=1S/C16H18N2O2S/c1-12-4-2-6-14(10-12)21(19,20)18-9-8-15-13(11-18)5-3-7-16(15)17/h2-7,10H,8-9,11,17H2,1H3 |
| InChIKey | DPCDMPYHIYFHCT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|