C19H23N3O2S — CID 18399942
2-(1-pyridin-3-ylsulfonylpiperidin-4-yl)-3,4-dihydro-1H-isoquinoline (PubChem CID 18399942) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-(1-pyridin-3-ylsulfonylpiperidin-4-yl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(1-pyridin-3-ylsulfonylpiperidin-4-yl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 18399942 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-(1-pyridin-3-ylsulfonylpiperidin-4-yl)-3,4-dihydro-1H-isoquinoline |
| SMILES | O=S(=O)(c1cccnc1)N1CCC(N2CCc3ccccc3C2)CC1 |
| InChI | InChI=1S/C19H23N3O2S/c23-25(24,19-6-3-10-20-14-19)22-12-8-18(9-13-22)21-11-7-16-4-1-2-5-17(16)15-21/h1-6,10,14,18H,7-9,11-13,15H2 |
| InChIKey | AZXOVEYTYTXVLG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |