C19H21N3O3S — CID 4137819
2,3-dihydroindol-1-yl-(1-pyridin-3-ylsulfonylpiperidin-4-yl)methanone (PubChem CID 4137819) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-(1-pyridin-3-ylsulfonylpiperidin-4-yl)methanone.
| Compound Name | 2,3-dihydroindol-1-yl-(1-pyridin-3-ylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 4137819 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2,3-dihydroindol-1-yl-(1-pyridin-3-ylsulfonylpiperidin-4-yl)methanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2cccnc2)CC1)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H21N3O3S/c23-19(22-13-9-15-4-1-2-6-18(15)22)16-7-11-21(12-8-16)26(24,25)17-5-3-10-20-14-17/h1-6,10,14,16H,7-9,11-13H2 |
| InChIKey | RUTUAUHWLHZEMR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |