C12H16N2O5S — CID 63877172
2-(1-pyridin-3-ylsulfonylpiperidin-4-yl)oxyacetic acid (PubChem CID 63877172) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-(1-pyridin-3-ylsulfonylpiperidin-4-yl)oxyacetic acid.
| Compound Name | 2-(1-pyridin-3-ylsulfonylpiperidin-4-yl)oxyacetic acid |
|---|---|
| PubChem CID | 63877172 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-(1-pyridin-3-ylsulfonylpiperidin-4-yl)oxyacetic acid |
| SMILES | O=C(O)COC1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C12H16N2O5S/c15-12(16)9-19-10-3-6-14(7-4-10)20(17,18)11-2-1-5-13-8-11/h1-2,5,8,10H,3-4,6-7,9H2,(H,15,16) |
| InChIKey | UNPWQHWJRYMRME-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |