C15H12Cl2N2O2S2 — CID 3551628
2-(2,5-dichlorothiophen-3-yl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 3551628) has the molecular formula C15H12Cl2N2O2S2 and a molecular weight of 387.31 g/mol. Its IUPAC name is 2-(2,5-dichlorothiophen-3-yl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-(2,5-dichlorothiophen-3-yl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 3551628 |
| Molecular Formula | C15H12Cl2N2O2S2 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 385.97 |
| IUPAC Name | 2-(2,5-dichlorothiophen-3-yl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | O=S(=O)(c1cc(Cl)sc1Cl)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C15H12Cl2N2O2S2/c16-14-7-13(15(17)22-14)23(20,21)19-6-5-10-9-3-1-2-4-11(9)18-12(10)8-19/h1-4,7,18H,5-6,8H2 |
| InChIKey | FFURBYGYHPALPI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|