C14H21N3O2S — CID 102977640
(3R)-1-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)piperidin-3-amine (PubChem CID 102977640) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is (3R)-1-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)piperidin-3-amine.
| Compound Name | (3R)-1-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)piperidin-3-amine |
|---|---|
| PubChem CID | 102977640 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (3R)-1-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)piperidin-3-amine |
| SMILES | N[C@@H]1CCCN(S(=O)(=O)N2CCc3ccccc3C2)C1 |
| InChI | InChI=1S/C14H21N3O2S/c15-14-6-3-8-16(11-14)20(18,19)17-9-7-12-4-1-2-5-13(12)10-17/h1-2,4-5,14H,3,6-11,15H2/t14-/m1/s1 |
| InChIKey | IYUSMFYEKGTWTH-CQSZACIVSA-N |
| XLogP | 0.71 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |