C8H14N3O4S2+ — CID 126509117
4-(3-methylimidazol-3-ium-1-yl)sulfonyl-1,4-thiazinane 1,1-dioxide (PubChem CID 126509117) has the molecular formula C8H14N3O4S2+ and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-(3-methylimidazol-3-ium-1-yl)sulfonyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(3-methylimidazol-3-ium-1-yl)sulfonyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 126509117 |
| Molecular Formula | C8H14N3O4S2+ |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 4-(3-methylimidazol-3-ium-1-yl)sulfonyl-1,4-thiazinane 1,1-dioxide |
| SMILES | C[n+]1ccn(S(=O)(=O)N2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C8H14N3O4S2/c1-9-2-3-11(8-9)17(14,15)10-4-6-16(12,13)7-5-10/h2-3,8H,4-7H2,1H3/q+1 |
| InChIKey | YFASEKLFULNXPE-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 80.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|