C14H21NO4S2 — CID 91029877
4-(4-tert-butylphenyl)sulfonyl-1,4-thiazinane 1,1-dioxide (PubChem CID 91029877) has the molecular formula C14H21NO4S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)sulfonyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(4-tert-butylphenyl)sulfonyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 91029877 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 4-(4-tert-butylphenyl)sulfonyl-1,4-thiazinane 1,1-dioxide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C14H21NO4S2/c1-14(2,3)12-4-6-13(7-5-12)21(18,19)15-8-10-20(16,17)11-9-15/h4-7H,8-11H2,1-3H3 |
| InChIKey | GOCQHVATRZNKGL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |