C9H14N3O3S+ — CID 43581824
(1,1-dioxo-1,4-thiazinan-4-yl)-(3-methylimidazol-3-ium-1-yl)methanone (PubChem CID 43581824) has the molecular formula C9H14N3O3S+ and a molecular weight of 244.30 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-(3-methylimidazol-3-ium-1-yl)methanone.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-(3-methylimidazol-3-ium-1-yl)methanone |
|---|---|
| PubChem CID | 43581824 |
| Molecular Formula | C9H14N3O3S+ |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-(3-methylimidazol-3-ium-1-yl)methanone |
| SMILES | C[n+]1ccn(C(=O)N2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C9H14N3O3S/c1-10-2-3-12(8-10)9(13)11-4-6-16(14,15)7-5-11/h2-3,8H,4-7H2,1H3/q+1 |
| InChIKey | KTGLUAXKKPQVAS-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 63.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|