C18H19F3IN3O — CID 175553575
(3-methylimidazol-3-ium-1-yl)-[4-(2,2,2-trifluoro-1-phenylethylidene)piperidin-1-yl]methanone iodide (PubChem CID 175553575) has the molecular formula C18H19F3IN3O and a molecular weight of 477.27 g/mol. Its IUPAC name is (3-methylimidazol-3-ium-1-yl)-[4-(2,2,2-trifluoro-1-phenylethylidene)piperidin-1-yl]methanone iodide.
| Compound Name | (3-methylimidazol-3-ium-1-yl)-[4-(2,2,2-trifluoro-1-phenylethylidene)piperidin-1-yl]methanone iodide |
|---|---|
| PubChem CID | 175553575 |
| Molecular Formula | C18H19F3IN3O |
| Molecular Weight | 477.27 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | (3-methylimidazol-3-ium-1-yl)-[4-(2,2,2-trifluoro-1-phenylethylidene)piperidin-1-yl]methanone iodide |
| SMILES | C[n+]1ccn(C(=O)N2CCC(=C(c3ccccc3)C(F)(F)F)CC2)c1.[I-] |
| InChI | InChI=1S/C18H19F3N3O.HI/c1-22-11-12-24(13-22)17(25)23-9-7-15(8-10-23)16(18(19,20)21)14-5-3-2-4-6-14;/h2-6,11-13H,7-10H2,1H3;1H/q+1;/p-1 |
| InChIKey | HAYVOJFMBOSINF-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|