C14H22N3O+ — CID 43620619
3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(3-methylimidazol-3-ium-1-yl)methanone (PubChem CID 43620619) has the molecular formula C14H22N3O+ and a molecular weight of 248.35 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(3-methylimidazol-3-ium-1-yl)methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(3-methylimidazol-3-ium-1-yl)methanone |
|---|---|
| PubChem CID | 43620619 |
| Molecular Formula | C14H22N3O+ |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(3-methylimidazol-3-ium-1-yl)methanone |
| SMILES | C[n+]1ccn(C(=O)N2CCC3CCCCC3C2)c1 |
| InChI | InChI=1S/C14H22N3O/c1-15-8-9-17(11-15)14(18)16-7-6-12-4-2-3-5-13(12)10-16/h8-9,11-13H,2-7,10H2,1H3/q+1 |
| InChIKey | OXTKAZQWCYECRS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|