C12H20N3O+ — CID 62124842
(2,3-dimethylpiperidin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone (PubChem CID 62124842) has the molecular formula C12H20N3O+ and a molecular weight of 222.31 g/mol. Its IUPAC name is (2,3-dimethylpiperidin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone.
| Compound Name | (2,3-dimethylpiperidin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone |
|---|---|
| PubChem CID | 62124842 |
| Molecular Formula | C12H20N3O+ |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (2,3-dimethylpiperidin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)n2cc[n+](C)c2)C1C |
| InChI | InChI=1S/C12H20N3O/c1-10-5-4-6-15(11(10)2)12(16)14-8-7-13(3)9-14/h7-11H,4-6H2,1-3H3/q+1 |
| InChIKey | GKYJDVUUCYSZBG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|