C16H27N4O3+ — CID 59332940
tert-butyl N-[[1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-4-yl]methyl]carbamate (PubChem CID 59332940) has the molecular formula C16H27N4O3+ and a molecular weight of 323.42 g/mol. Its IUPAC name is tert-butyl N-[[1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 59332940 |
| Molecular Formula | C16H27N4O3+ |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | tert-butyl N-[[1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-4-yl]methyl]carbamate |
| SMILES | C[n+]1ccn(C(=O)N2CCC(CNC(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C16H26N4O3/c1-16(2,3)23-14(21)17-11-13-5-7-19(8-6-13)15(22)20-10-9-18(4)12-20/h9-10,12-13H,5-8,11H2,1-4H3/p+1 |
| InChIKey | JBFXJXHTCZBNSS-UHFFFAOYSA-O |
| XLogP | 1.52 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|